C29H28N2O6 — CID 11249065
2-O-ethyl 3-O-methyl (3aS,6S)-5-(4-methoxyphenyl)-3a,6-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-2,3-dicarboxylate (PubChem CID 11249065) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-O-ethyl 3-O-methyl (3aS,6S)-5-(4-methoxyphenyl)-3a,6-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-2,3-dicarboxylate.
| Compound Name | 2-O-ethyl 3-O-methyl (3aS,6S)-5-(4-methoxyphenyl)-3a,6-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11249065 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 2-O-ethyl 3-O-methyl (3aS,6S)-5-(4-methoxyphenyl)-3a,6-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OC)[C@@]2(c3ccccc3)CN(c3ccc(OC)cc3)[C@H](c3ccccc3)N2O1 |
| InChI | InChI=1S/C29H28N2O6/c1-4-36-28(33)25-24(27(32)35-3)29(21-13-9-6-10-14-21)19-30(22-15-17-23(34-2)18-16-22)26(31(29)37-25)20-11-7-5-8-12-20/h5-18,26H,4,19H2,1-3H3/t26-,29-/m0/s1 |
| InChIKey | VITKGTANLPDNDM-WNJJXGMVSA-N |
| XLogP | 4.35 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|