C34H43NO12 — CID 11250852
[(1R,3S,4R,6R,8R,10R,12R,13R,14S,15S)-1,10,12,14-tetraacetyloxy-3,7,7,15-tetramethyl-11-methylidene-2-oxo-5-oxatricyclo[11.3.0.04,6]hexadecan-8-yl] pyridine-3-carboxylate (PubChem CID 11250852) has the molecular formula C34H43NO12 and a molecular weight of 657.71 g/mol. Its IUPAC name is [(1R,3S,4R,6R,8R,10R,12R,13R,14S,15S)-1,10,12,14-tetraacetyloxy-3,7,7,15-tetramethyl-11-methylidene-2-oxo-5-oxatricyclo[11.3.0.04,6]hexadecan-8-yl] pyridine-3-carboxylate.
| Compound Name | [(1R,3S,4R,6R,8R,10R,12R,13R,14S,15S)-1,10,12,14-tetraacetyloxy-3,7,7,15-tetramethyl-11-methylidene-2-oxo-5-oxatricyclo[11.3.0.04,6]hexadecan-8-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 11250852 |
| Molecular Formula | C34H43NO12 |
| Molecular Weight | 657.71 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | [(1R,3S,4R,6R,8R,10R,12R,13R,14S,15S)-1,10,12,14-tetraacetyloxy-3,7,7,15-tetramethyl-11-methylidene-2-oxo-5-oxatricyclo[11.3.0.04,6]hexadecan-8-yl] pyridine-3-carboxylate |
| SMILES | C=C1[C@H](OC(C)=O)C[C@@H](OC(=O)c2cccnc2)C(C)(C)[C@H]2O[C@@H]2[C@H](C)C(=O)[C@@]2(OC(C)=O)C[C@H](C)[C@H](OC(C)=O)[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C34H43NO12/c1-16-14-34(47-22(7)39)26(27(16)43-20(5)37)28(44-21(6)38)17(2)24(42-19(4)36)13-25(45-32(41)23-11-10-12-35-15-23)33(8,9)31-29(46-31)18(3)30(34)40/h10-12,15-16,18,24-29,31H,2,13-14H2,1,3-9H3/t16-,18-,24+,25+,26+,27-,28-,29+,31-,34+/m0/s1 |
| InChIKey | YAQJUDMDTLVWQD-JZHJPFDYSA-N |
| XLogP | 3.32 |
| TPSA | 173.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|