C37H32N4O9 — CID 11250955
[(2R,4aR,6S,7R,8R,8aS)-7-(1,3-dioxoisoindol-2-yl)-6-(4-methoxyphenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-[2-(azidomethyl)phenyl]acetate (PubChem CID 11250955) has the molecular formula C37H32N4O9 and a molecular weight of 676.68 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aS)-7-(1,3-dioxoisoindol-2-yl)-6-(4-methoxyphenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-[2-(azidomethyl)phenyl]acetate.
| Compound Name | [(2R,4aR,6S,7R,8R,8aS)-7-(1,3-dioxoisoindol-2-yl)-6-(4-methoxyphenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-[2-(azidomethyl)phenyl]acetate |
|---|---|
| PubChem CID | 11250955 |
| Molecular Formula | C37H32N4O9 |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aS)-7-(1,3-dioxoisoindol-2-yl)-6-(4-methoxyphenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-[2-(azidomethyl)phenyl]acetate |
| SMILES | COc1ccc(O[C@@H]2O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3[C@H](OC(=O)Cc3ccccc3CN=[N+]=[N-])[C@H]2N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C37H32N4O9/c1-45-25-15-17-26(18-16-25)47-37-31(41-34(43)27-13-7-8-14-28(27)35(41)44)33(49-30(42)19-23-11-5-6-12-24(23)20-39-40-38)32-29(48-37)21-46-36(50-32)22-9-3-2-4-10-22/h2-18,29,31-33,36-37H,19-21H2,1H3/t29-,31-,32-,33-,36-,37-/m1/s1 |
| InChIKey | HIIXNIHOTHZUJL-WIRAJARKSA-N |
| XLogP | 5.54 |
| TPSA | 158.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|