C16H28N2 — CID 112516072
2-(4-tert-butylphenyl)-N,N-dimethylbutane-1,4-diamine (PubChem CID 112516072) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N,N-dimethylbutane-1,4-diamine.
| Compound Name | 2-(4-tert-butylphenyl)-N,N-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 112516072 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N,N-dimethylbutane-1,4-diamine |
| SMILES | CN(C)CC(CCN)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H28N2/c1-16(2,3)15-8-6-13(7-9-15)14(10-11-17)12-18(4)5/h6-9,14H,10-12,17H2,1-5H3 |
| InChIKey | HQCWRAFOJZFSEG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |