C13H22N2O2S — CID 112517542
N,N-dimethyl-2-(4-methylsulfonylphenyl)butane-1,4-diamine (PubChem CID 112517542) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-methylsulfonylphenyl)butane-1,4-diamine.
| Compound Name | N,N-dimethyl-2-(4-methylsulfonylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 112517542 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N,N-dimethyl-2-(4-methylsulfonylphenyl)butane-1,4-diamine |
| SMILES | CN(C)CC(CCN)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H22N2O2S/c1-15(2)10-12(8-9-14)11-4-6-13(7-5-11)18(3,16)17/h4-7,12H,8-10,14H2,1-3H3 |
| InChIKey | CBWNPAVWORWGEA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |