C16H22N2O — CID 112516683
4-cyano-N-(3,5-dimethylphenyl)heptanamide (PubChem CID 112516683) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-cyano-N-(3,5-dimethylphenyl)heptanamide.
| Compound Name | 4-cyano-N-(3,5-dimethylphenyl)heptanamide |
|---|---|
| PubChem CID | 112516683 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4-cyano-N-(3,5-dimethylphenyl)heptanamide |
| SMILES | CCCC(C#N)CCC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H22N2O/c1-4-5-14(11-17)6-7-16(19)18-15-9-12(2)8-13(3)10-15/h8-10,14H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | OOVBZZIJPIKNHH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |