C11H14ClNO4 — CID 112519196
2-(3-chloro-4-methoxyanilino)-3-methoxypropanoic acid (PubChem CID 112519196) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyanilino)-3-methoxypropanoic acid.
| Compound Name | 2-(3-chloro-4-methoxyanilino)-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 112519196 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-(3-chloro-4-methoxyanilino)-3-methoxypropanoic acid |
| SMILES | COCC(Nc1ccc(OC)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H14ClNO4/c1-16-6-9(11(14)15)13-7-3-4-10(17-2)8(12)5-7/h3-5,9,13H,6H2,1-2H3,(H,14,15) |
| InChIKey | PHIANJXSPWPAQE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|