C15H24ClNO — CID 112519815
2-(3-chloro-4-ethoxyphenyl)-2,4-dimethylpentan-1-amine (PubChem CID 112519815) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 2-(3-chloro-4-ethoxyphenyl)-2,4-dimethylpentan-1-amine.
| Compound Name | 2-(3-chloro-4-ethoxyphenyl)-2,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 112519815 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-(3-chloro-4-ethoxyphenyl)-2,4-dimethylpentan-1-amine |
| SMILES | CCOc1ccc(C(C)(CN)CC(C)C)cc1Cl |
| InChI | InChI=1S/C15H24ClNO/c1-5-18-14-7-6-12(8-13(14)16)15(4,10-17)9-11(2)3/h6-8,11H,5,9-10,17H2,1-4H3 |
| InChIKey | COUMHMXZOWOYKV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |