C18H16BrNO3 — CID 112529275
4-bromo-N-[2-(2-methoxyphenyl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 112529275) has the molecular formula C18H16BrNO3 and a molecular weight of 374.23 g/mol. Its IUPAC name is 4-bromo-N-[2-(2-methoxyphenyl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 4-bromo-N-[2-(2-methoxyphenyl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 112529275 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 4-bromo-N-[2-(2-methoxyphenyl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)c1cc2c(Br)cccc2o1 |
| InChI | InChI=1S/C18H16BrNO3/c1-22-15-7-3-2-5-12(15)9-10-20-18(21)17-11-13-14(19)6-4-8-16(13)23-17/h2-8,11H,9-10H2,1H3,(H,20,21) |
| InChIKey | HMQXXXAWCVXCMB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |