C13H13BrN2O3 — CID 84577585
4-bromo-N-(3-formamidopropyl)-1-benzofuran-2-carboxamide (PubChem CID 84577585) has the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. Its IUPAC name is 4-bromo-N-(3-formamidopropyl)-1-benzofuran-2-carboxamide.
| Compound Name | 4-bromo-N-(3-formamidopropyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 84577585 |
| Molecular Formula | C13H13BrN2O3 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-bromo-N-(3-formamidopropyl)-1-benzofuran-2-carboxamide |
| SMILES | O=CNCCCNC(=O)c1cc2c(Br)cccc2o1 |
| InChI | InChI=1S/C13H13BrN2O3/c14-10-3-1-4-11-9(10)7-12(19-11)13(18)16-6-2-5-15-8-17/h1,3-4,7-8H,2,5-6H2,(H,15,17)(H,16,18) |
| InChIKey | FEHAQXGLEUEECQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|