C17H13Br2NO2 — CID 112529138
4-bromo-N-[2-(4-bromophenyl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 112529138) has the molecular formula C17H13Br2NO2 and a molecular weight of 423.10 g/mol. Its IUPAC name is 4-bromo-N-[2-(4-bromophenyl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 4-bromo-N-[2-(4-bromophenyl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 112529138 |
| Molecular Formula | C17H13Br2NO2 |
| Molecular Weight | 423.10 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | 4-bromo-N-[2-(4-bromophenyl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCc1ccc(Br)cc1)c1cc2c(Br)cccc2o1 |
| InChI | InChI=1S/C17H13Br2NO2/c18-12-6-4-11(5-7-12)8-9-20-17(21)16-10-13-14(19)2-1-3-15(13)22-16/h1-7,10H,8-9H2,(H,20,21) |
| InChIKey | UKKGGPFGEUDUKI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.10 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |