C15H26O2 — CID 11253413
[(1E,3E)-5-(2-methoxypropan-2-yloxy)penta-1,3-dienyl]cyclohexane (PubChem CID 11253413) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is [(1E,3E)-5-(2-methoxypropan-2-yloxy)penta-1,3-dienyl]cyclohexane.
| Compound Name | [(1E,3E)-5-(2-methoxypropan-2-yloxy)penta-1,3-dienyl]cyclohexane |
|---|---|
| PubChem CID | 11253413 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | [(1E,3E)-5-(2-methoxypropan-2-yloxy)penta-1,3-dienyl]cyclohexane |
| SMILES | COC(C)(C)OC/C=C/C=C/C1CCCCC1 |
| InChI | InChI=1S/C15H26O2/c1-15(2,16-3)17-13-9-5-8-12-14-10-6-4-7-11-14/h5,8-9,12,14H,4,6-7,10-11,13H2,1-3H3/b9-5+,12-8+ |
| InChIKey | RRPPRDHIFBOKLV-PIHCAMFYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|