C15H20ClNO3 — CID 112534858
2-(3-chlorophenyl)-1-(4,4-dimethoxypiperidin-1-yl)ethanone (PubChem CID 112534858) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(4,4-dimethoxypiperidin-1-yl)ethanone.
| Compound Name | 2-(3-chlorophenyl)-1-(4,4-dimethoxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 112534858 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(4,4-dimethoxypiperidin-1-yl)ethanone |
| SMILES | COC1(OC)CCN(C(=O)Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H20ClNO3/c1-19-15(20-2)6-8-17(9-7-15)14(18)11-12-4-3-5-13(16)10-12/h3-5,10H,6-9,11H2,1-2H3 |
| InChIKey | HMKYJOHSCLBXIO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|