C17H15BrN2O3 — CID 112536983
(5-bromo-7-nitro-2,3-dihydroindol-1-yl)-(3,4-dimethylphenyl)methanone (PubChem CID 112536983) has the molecular formula C17H15BrN2O3 and a molecular weight of 375.22 g/mol. Its IUPAC name is (5-bromo-7-nitro-2,3-dihydroindol-1-yl)-(3,4-dimethylphenyl)methanone.
| Compound Name | (5-bromo-7-nitro-2,3-dihydroindol-1-yl)-(3,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 112536983 |
| Molecular Formula | C17H15BrN2O3 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (5-bromo-7-nitro-2,3-dihydroindol-1-yl)-(3,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCc3cc(Br)cc([N+](=O)[O-])c32)cc1C |
| InChI | InChI=1S/C17H15BrN2O3/c1-10-3-4-13(7-11(10)2)17(21)19-6-5-12-8-14(18)9-15(16(12)19)20(22)23/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | FSLITHRZBLDGGQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|