C13H16BrN3O3 — CID 112536945
1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)-3-(dimethylamino)propan-1-one (PubChem CID 112536945) has the molecular formula C13H16BrN3O3 and a molecular weight of 342.19 g/mol. Its IUPAC name is 1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)-3-(dimethylamino)propan-1-one.
| Compound Name | 1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)-3-(dimethylamino)propan-1-one |
|---|---|
| PubChem CID | 112536945 |
| Molecular Formula | C13H16BrN3O3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)-3-(dimethylamino)propan-1-one |
| SMILES | CN(C)CCC(=O)N1CCc2cc(Br)cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C13H16BrN3O3/c1-15(2)5-4-12(18)16-6-3-9-7-10(14)8-11(13(9)16)17(19)20/h7-8H,3-6H2,1-2H3 |
| InChIKey | LVOILUGWBRVKTD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|