5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride

C9H6ClN3O5 — CID 23649532

IUPAC5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride
SMILESO=C(Cl)N1CCc2cc([N+](=O)[O-])cc([N+](=O)[O-])c21
InChIInChI=1S/C9H6ClN3O5/c10-9(14)11-2-1-5-3-6(12(15)16)4-7(8(5)11)13(17)18/h3-4H,1-2H2
InChIKeyDDURQDACBVLVOY-UHFFFAOYSA-N
MW271.62 g/mol
LogP2.22
Rot. Bonds2

About 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride

5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride (PubChem CID 23649532) has the molecular formula C9H6ClN3O5 and a molecular weight of 271.62 g/mol. Its IUPAC name is 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride.

Molecular Properties

Compound Name5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride
PubChem CID23649532
Molecular FormulaC9H6ClN3O5
Molecular Weight271.62 g/mol
Exact Mass271.00
IUPAC Name5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride
SMILESO=C(Cl)N1CCc2cc([N+](=O)[O-])cc([N+](=O)[O-])c21
InChIInChI=1S/C9H6ClN3O5/c10-9(14)11-2-1-5-3-6(12(15)16)4-7(8(5)11)13(17)18/h3-4H,1-2H2
InChIKeyDDURQDACBVLVOY-UHFFFAOYSA-N
XLogP2.22
TPSA106.59 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.62
LogP ≤ 52.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride?
The IUPAC name of 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride (CID 23649532) is 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride.
What is the SMILES notation for 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride?
The canonical SMILES for 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride is O=C(Cl)N1CCc2cc([N+](=O)[O-])cc([N+](=O)[O-])c21.
What is the InChIKey of 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride?
The InChIKey is DDURQDACBVLVOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN3O5/c10-9(14)11-2-1-5-3-6(12(15)16)4-7(8(5)11)13(17)18/h3-4H,1-2H2.
What are the key properties of 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride?
5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride has a molecular weight of 271.62 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride is sourced from PubChem (CID 23649532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).