C9H6ClN3O5 — CID 23649532
5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride (PubChem CID 23649532) has the molecular formula C9H6ClN3O5 and a molecular weight of 271.62 g/mol. Its IUPAC name is 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride.
| Compound Name | 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride |
|---|---|
| PubChem CID | 23649532 |
| Molecular Formula | C9H6ClN3O5 |
| Molecular Weight | 271.62 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 5,7-dinitro-2,3-dihydroindole-1-carbonyl chloride |
| SMILES | O=C(Cl)N1CCc2cc([N+](=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C9H6ClN3O5/c10-9(14)11-2-1-5-3-6(12(15)16)4-7(8(5)11)13(17)18/h3-4H,1-2H2 |
| InChIKey | DDURQDACBVLVOY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|