C16H13BrN2O4 — CID 112537015
1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)-2-phenoxyethanone (PubChem CID 112537015) has the molecular formula C16H13BrN2O4 and a molecular weight of 377.19 g/mol. Its IUPAC name is 1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)-2-phenoxyethanone.
| Compound Name | 1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)-2-phenoxyethanone |
|---|---|
| PubChem CID | 112537015 |
| Molecular Formula | C16H13BrN2O4 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCc2cc(Br)cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C16H13BrN2O4/c17-12-8-11-6-7-18(16(11)14(9-12)19(21)22)15(20)10-23-13-4-2-1-3-5-13/h1-5,8-9H,6-7,10H2 |
| InChIKey | BRHQJLMOGRZOCA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|