C18H28N2O — CID 112542777
N-[1-(3,4-dimethylphenyl)-5-methylpiperidin-3-yl]-2-methylpropanamide (PubChem CID 112542777) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-5-methylpiperidin-3-yl]-2-methylpropanamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)-5-methylpiperidin-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 112542777 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-5-methylpiperidin-3-yl]-2-methylpropanamide |
| SMILES | Cc1ccc(N2CC(C)CC(NC(=O)C(C)C)C2)cc1C |
| InChI | InChI=1S/C18H28N2O/c1-12(2)18(21)19-16-8-13(3)10-20(11-16)17-7-6-14(4)15(5)9-17/h6-7,9,12-13,16H,8,10-11H2,1-5H3,(H,19,21) |
| InChIKey | KCZIOFMVXRECTL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|