C24H30N4O — CID 164972635
(2S,3S)-3-(1H-benzimidazol-2-yl)-N-[(3R)-1-(3,4-dimethylphenyl)pyrrolidin-3-yl]-2-methylbutanamide (PubChem CID 164972635) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is (2S,3S)-3-(1H-benzimidazol-2-yl)-N-[(3R)-1-(3,4-dimethylphenyl)pyrrolidin-3-yl]-2-methylbutanamide.
| Compound Name | (2S,3S)-3-(1H-benzimidazol-2-yl)-N-[(3R)-1-(3,4-dimethylphenyl)pyrrolidin-3-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 164972635 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (2S,3S)-3-(1H-benzimidazol-2-yl)-N-[(3R)-1-(3,4-dimethylphenyl)pyrrolidin-3-yl]-2-methylbutanamide |
| SMILES | Cc1ccc(N2CC[C@@H](NC(=O)[C@@H](C)[C@H](C)c3nc4ccccc4[nH]3)C2)cc1C |
| InChI | InChI=1S/C24H30N4O/c1-15-9-10-20(13-16(15)2)28-12-11-19(14-28)25-24(29)18(4)17(3)23-26-21-7-5-6-8-22(21)27-23/h5-10,13,17-19H,11-12,14H2,1-4H3,(H,25,29)(H,26,27)/t17-,18-,19+/m0/s1 |
| InChIKey | DIJGNZPSNPEJAA-GBESFXJTSA-N |
| XLogP | 4.31 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|