C18H27N3O3 — CID 112545003
benzyl N-(5-butyl-1-carbamoylpiperidin-3-yl)carbamate (PubChem CID 112545003) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is benzyl N-(5-butyl-1-carbamoylpiperidin-3-yl)carbamate.
| Compound Name | benzyl N-(5-butyl-1-carbamoylpiperidin-3-yl)carbamate |
|---|---|
| PubChem CID | 112545003 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | benzyl N-(5-butyl-1-carbamoylpiperidin-3-yl)carbamate |
| SMILES | CCCCC1CC(NC(=O)OCc2ccccc2)CN(C(N)=O)C1 |
| InChI | InChI=1S/C18H27N3O3/c1-2-3-7-15-10-16(12-21(11-15)17(19)22)20-18(23)24-13-14-8-5-4-6-9-14/h4-6,8-9,15-16H,2-3,7,10-13H2,1H3,(H2,19,22)(H,20,23) |
| InChIKey | DGDJGAURMIJNKS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |