C7H10N2O2 — CID 112545269
2-(3,5-dimethyl-2-oxoimidazol-1-yl)acetaldehyde (PubChem CID 112545269) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-(3,5-dimethyl-2-oxoimidazol-1-yl)acetaldehyde.
| Compound Name | 2-(3,5-dimethyl-2-oxoimidazol-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 112545269 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 2-(3,5-dimethyl-2-oxoimidazol-1-yl)acetaldehyde |
| SMILES | Cc1cn(C)c(=O)n1CC=O |
| InChI | InChI=1S/C7H10N2O2/c1-6-5-8(2)7(11)9(6)3-4-10/h4-5H,3H2,1-2H3 |
| InChIKey | LAIUSLFGOXSOPS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|