C6H8N2O2 — CID 83681681
1,3-dimethyl-2-oxoimidazole-4-carbaldehyde (PubChem CID 83681681) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 1,3-dimethyl-2-oxoimidazole-4-carbaldehyde.
| Compound Name | 1,3-dimethyl-2-oxoimidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 83681681 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1,3-dimethyl-2-oxoimidazole-4-carbaldehyde |
| SMILES | Cn1cc(C=O)n(C)c1=O |
| InChI | InChI=1S/C6H8N2O2/c1-7-3-5(4-9)8(2)6(7)10/h3-4H,1-2H3 |
| InChIKey | LVTSMSNYFUNZIZ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|