C5H8N2O — CID 143200931
3-methyl-1,2-dihydroimidazole-4-carbaldehyde (PubChem CID 143200931) has the molecular formula C5H8N2O and a molecular weight of 112.13 g/mol. Its IUPAC name is 3-methyl-1,2-dihydroimidazole-4-carbaldehyde.
| Compound Name | 3-methyl-1,2-dihydroimidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 143200931 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 3-methyl-1,2-dihydroimidazole-4-carbaldehyde |
| SMILES | CN1CNC=C1C=O |
| InChI | InChI=1S/C5H8N2O/c1-7-4-6-2-5(7)3-8/h2-3,6H,4H2,1H3 |
| InChIKey | RSEABPHZLJJJSQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|