About (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite
(5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite (PubChem CID 168982735) has the molecular formula C5H7FN2OS
and a molecular weight of 162.19 g/mol. Its IUPAC name is (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite.
Molecular Properties
| Compound Name | (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite |
| PubChem CID | 168982735 |
| Molecular Formula | C5H7FN2OS |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite |
| SMILES | CC1NC(C=O)=CN1SF |
| InChI | InChI=1S/C5H7FN2OS/c1-4-7-5(3-9)2-8(4)10-6/h2-4,7H,1H3 |
| InChIKey | XGVYXXBBGNYHAV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite?
The IUPAC name of (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite (CID 168982735) is (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite.
What is the SMILES notation for (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite?
The canonical SMILES for (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite is CC1NC(C=O)=CN1SF.
What is the InChIKey of (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite?
The InChIKey is XGVYXXBBGNYHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FN2OS/c1-4-7-5(3-9)2-8(4)10-6/h2-4,7H,1H3.
What are the key properties of (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite?
(5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite has a molecular weight of 162.19 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-formyl-2-methyl-1,2-dihydroimidazol-3-yl) thiohypofluorite is sourced from PubChem (CID 168982735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).