C4H4N2O2 — CID 2724951
2-oxo-1,3-dihydroimidazole-4-carbaldehyde (PubChem CID 2724951) has the molecular formula C4H4N2O2 and a molecular weight of 112.09 g/mol. Its IUPAC name is 2-oxo-1,3-dihydroimidazole-4-carbaldehyde.
| Compound Name | 2-oxo-1,3-dihydroimidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 2724951 |
| Molecular Formula | C4H4N2O2 |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.03 |
| IUPAC Name | 2-oxo-1,3-dihydroimidazole-4-carbaldehyde |
| SMILES | O=Cc1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O2/c7-2-3-1-5-4(8)6-3/h1-2H,(H2,5,6,8) |
| InChIKey | XYBQLONABMMZQU-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|