About 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde
3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde (PubChem CID 87261781) has the molecular formula C6H9BrN2O2
and a molecular weight of 221.05 g/mol. Its IUPAC name is 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde |
| PubChem CID | 87261781 |
| Molecular Formula | C6H9BrN2O2 |
| Molecular Weight | 221.05 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde |
| SMILES | CCOC1NC(C=O)=CN1Br |
| InChI | InChI=1S/C6H9BrN2O2/c1-2-11-6-8-5(4-10)3-9(6)7/h3-4,6,8H,2H2,1H3 |
| InChIKey | HDWHXUWPGJDQCE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.05 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde?
The IUPAC name of 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde (CID 87261781) is 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde.
What is the SMILES notation for 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde?
The canonical SMILES for 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde is CCOC1NC(C=O)=CN1Br.
What is the InChIKey of 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde?
The InChIKey is HDWHXUWPGJDQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2O2/c1-2-11-6-8-5(4-10)3-9(6)7/h3-4,6,8H,2H2,1H3.
What are the key properties of 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde?
3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde has a molecular weight of 221.05 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-ethoxy-1,2-dihydroimidazole-5-carbaldehyde is sourced from PubChem (CID 87261781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).