C7H8N2O3 — CID 57189768
3-methyl-2H-imidazole-1,2,4-tricarbaldehyde (PubChem CID 57189768) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 3-methyl-2H-imidazole-1,2,4-tricarbaldehyde.
| Compound Name | 3-methyl-2H-imidazole-1,2,4-tricarbaldehyde |
|---|---|
| PubChem CID | 57189768 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 3-methyl-2H-imidazole-1,2,4-tricarbaldehyde |
| SMILES | CN1C(C=O)=CN(C=O)C1C=O |
| InChI | InChI=1S/C7H8N2O3/c1-8-6(3-10)2-9(5-12)7(8)4-11/h2-5,7H,1H3 |
| InChIKey | RBXKZKHEHBDKFM-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|