C10H11NO2S — CID 112546073
2-(2-aminoethyl)-1-benzothiophene-3,7-diol (PubChem CID 112546073) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-(2-aminoethyl)-1-benzothiophene-3,7-diol.
| Compound Name | 2-(2-aminoethyl)-1-benzothiophene-3,7-diol |
|---|---|
| PubChem CID | 112546073 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-(2-aminoethyl)-1-benzothiophene-3,7-diol |
| SMILES | NCCc1sc2c(O)cccc2c1O |
| InChI | InChI=1S/C10H11NO2S/c11-5-4-8-9(13)6-2-1-3-7(12)10(6)14-8/h1-3,12-13H,4-5,11H2 |
| InChIKey | MCTALXAGCWVILM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|