C12H7ClNa2O4 — CID 11254955
disodium;(3E,5Z)-6-(4-chlorophenyl)-6-oxido-2-oxohexa-3,5-dienoate (PubChem CID 11254955) has the molecular formula C12H7ClNa2O4 and a molecular weight of 296.62 g/mol. Its IUPAC name is disodium;(3E,5Z)-6-(4-chlorophenyl)-6-oxido-2-oxohexa-3,5-dienoate.
| Compound Name | disodium;(3E,5Z)-6-(4-chlorophenyl)-6-oxido-2-oxohexa-3,5-dienoate |
|---|---|
| PubChem CID | 11254955 |
| Molecular Formula | C12H7ClNa2O4 |
| Molecular Weight | 296.62 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | disodium;(3E,5Z)-6-(4-chlorophenyl)-6-oxido-2-oxohexa-3,5-dienoate |
| SMILES | O=C([O-])C(=O)/C=C/C=C(\[O-])c1ccc(Cl)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C12H9ClO4.2Na/c13-9-6-4-8(5-7-9)10(14)2-1-3-11(15)12(16)17;;/h1-7,14H,(H,16,17);;/q;2*+1/p-2/b3-1+,10-2-;; |
| InChIKey | GXCNVHWHMKSNNY-DZYKCOGJSA-L |
| XLogP | -6.08 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.62 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|