About 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride
7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride (PubChem CID 112552680) has the molecular formula C11H13ClN2O3S
and a molecular weight of 288.76 g/mol. Its IUPAC name is 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride |
| PubChem CID | 112552680 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride |
| SMILES | COc1ccn2c(C(C)C)nc(S(=O)(=O)Cl)c2c1 |
| InChI | InChI=1S/C11H13ClN2O3S/c1-7(2)10-13-11(18(12,15)16)9-6-8(17-3)4-5-14(9)10/h4-7H,1-3H3 |
| InChIKey | XQLGIRIURXQWBT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride?
The IUPAC name of 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride (CID 112552680) is 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride.
What is the SMILES notation for 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride?
The canonical SMILES for 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride is COc1ccn2c(C(C)C)nc(S(=O)(=O)Cl)c2c1.
What is the InChIKey of 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride?
The InChIKey is XQLGIRIURXQWBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O3S/c1-7(2)10-13-11(18(12,15)16)9-6-8(17-3)4-5-14(9)10/h4-7H,1-3H3.
What are the key properties of 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride?
7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride has a molecular weight of 288.76 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3-propan-2-ylimidazo[1,5-a]pyridine-1-sulfonyl chloride is sourced from PubChem (CID 112552680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).