About CID 11255567
CID 11255567 (PubChem CID 11255567) has the molecular formula C14H15O
and a molecular weight of 199.27 g/mol.
Molecular Properties
| Compound Name | CID 11255567 |
| PubChem CID | 11255567 |
| Molecular Formula | C14H15O |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | — |
| SMILES | CC(C)([C]1[CH][CH][CH][CH]1)c1ccccc1O |
| InChI | InChI=1S/C14H15O/c1-14(2,11-7-3-4-8-11)12-9-5-6-10-13(12)15/h3-10,15H,1-2H3 |
| InChIKey | RZTDQXNEEOBYDF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 11255567 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11255567?
The IUPAC name of CID 11255567 (CID 11255567) is not available.
What is the SMILES notation for CID 11255567?
The canonical SMILES for CID 11255567 is CC(C)([C]1[CH][CH][CH][CH]1)c1ccccc1O.
What is the InChIKey of CID 11255567?
The InChIKey is RZTDQXNEEOBYDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15O/c1-14(2,11-7-3-4-8-11)12-9-5-6-10-13(12)15/h3-10,15H,1-2H3.
What are the key properties of CID 11255567?
CID 11255567 has a molecular weight of 199.27 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11255567 is sourced from PubChem (CID 11255567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).