C12H17BrN2O — CID 112561690
1-bromo-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-2-ol (PubChem CID 112561690) has the molecular formula C12H17BrN2O and a molecular weight of 285.19 g/mol. Its IUPAC name is 1-bromo-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-2-ol.
| Compound Name | 1-bromo-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 112561690 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-bromo-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-2-ol |
| SMILES | CN1CCN(CC(O)CBr)c2ccccc21 |
| InChI | InChI=1S/C12H17BrN2O/c1-14-6-7-15(9-10(16)8-13)12-5-3-2-4-11(12)14/h2-5,10,16H,6-9H2,1H3 |
| InChIKey | XAJVOYUTPOVLSK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|