6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid

C14H12BrNO2 — CID 112562057

IUPAC6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid
SMILESCc1cc(C(=O)O)c(C)nc1-c1ccc(Br)cc1
InChIInChI=1S/C14H12BrNO2/c1-8-7-12(14(17)18)9(2)16-13(8)10-3-5-11(15)6-4-10/h3-7H,1-2H3,(H,17,18)
InChIKeyZZQNJGKJOKTFAK-UHFFFAOYSA-N
MW306.16 g/mol
LogP3.83
Rot. Bonds2

About 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid

6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid (PubChem CID 112562057) has the molecular formula C14H12BrNO2 and a molecular weight of 306.16 g/mol. Its IUPAC name is 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid
PubChem CID112562057
Molecular FormulaC14H12BrNO2
Molecular Weight306.16 g/mol
Exact Mass305.01
IUPAC Name6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid
SMILESCc1cc(C(=O)O)c(C)nc1-c1ccc(Br)cc1
InChIInChI=1S/C14H12BrNO2/c1-8-7-12(14(17)18)9(2)16-13(8)10-3-5-11(15)6-4-10/h3-7H,1-2H3,(H,17,18)
InChIKeyZZQNJGKJOKTFAK-UHFFFAOYSA-N
XLogP3.83
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.16
LogP ≤ 53.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid?
The IUPAC name of 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid (CID 112562057) is 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid.
What is the SMILES notation for 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid?
The canonical SMILES for 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid is Cc1cc(C(=O)O)c(C)nc1-c1ccc(Br)cc1.
What is the InChIKey of 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid?
The InChIKey is ZZQNJGKJOKTFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrNO2/c1-8-7-12(14(17)18)9(2)16-13(8)10-3-5-11(15)6-4-10/h3-7H,1-2H3,(H,17,18).
What are the key properties of 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid?
6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid has a molecular weight of 306.16 g/mol, XLogP of 3.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-bromophenyl)-2,5-dimethylpyridine-3-carboxylic acid is sourced from PubChem (CID 112562057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).