2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid

C16H12N2O4 — CID 2749573

IUPAC2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid
SMILESCc1nc2cc3nc(C)c(C(=O)O)cc3cc2cc1C(=O)O
InChIInChI=1S/C16H12N2O4/c1-7-11(15(19)20)4-9-3-10-5-12(16(21)22)8(2)18-14(10)6-13(9)17-7/h3-6H,1-2H3,(H,19,20)(H,21,22)
InChIKeySPXNMONQOUGWKS-UHFFFAOYSA-N
MW296.28 g/mol
LogP2.80
Rot. Bonds2

About 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid

2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid (PubChem CID 2749573) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid.

Molecular Properties

Compound Name2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid
PubChem CID2749573
Molecular FormulaC16H12N2O4
Molecular Weight296.28 g/mol
Exact Mass296.08
IUPAC Name2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid
SMILESCc1nc2cc3nc(C)c(C(=O)O)cc3cc2cc1C(=O)O
InChIInChI=1S/C16H12N2O4/c1-7-11(15(19)20)4-9-3-10-5-12(16(21)22)8(2)18-14(10)6-13(9)17-7/h3-6H,1-2H3,(H,19,20)(H,21,22)
InChIKeySPXNMONQOUGWKS-UHFFFAOYSA-N
XLogP2.80
TPSA100.38 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.28
LogP ≤ 52.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid?
The IUPAC name of 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid (CID 2749573) is 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid.
What is the SMILES notation for 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid?
The canonical SMILES for 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid is Cc1nc2cc3nc(C)c(C(=O)O)cc3cc2cc1C(=O)O.
What is the InChIKey of 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid?
The InChIKey is SPXNMONQOUGWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O4/c1-7-11(15(19)20)4-9-3-10-5-12(16(21)22)8(2)18-14(10)6-13(9)17-7/h3-6H,1-2H3,(H,19,20)(H,21,22).
What are the key properties of 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid?
2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid has a molecular weight of 296.28 g/mol, XLogP of 2.80, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid is sourced from PubChem (CID 2749573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).