C16H12N2O4 — CID 2749573
2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid (PubChem CID 2749573) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid.
| Compound Name | 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid |
|---|---|
| PubChem CID | 2749573 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,8-dimethylpyrido[3,2-g]quinoline-3,7-dicarboxylic acid |
| SMILES | Cc1nc2cc3nc(C)c(C(=O)O)cc3cc2cc1C(=O)O |
| InChI | InChI=1S/C16H12N2O4/c1-7-11(15(19)20)4-9-3-10-5-12(16(21)22)8(2)18-14(10)6-13(9)17-7/h3-6H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | SPXNMONQOUGWKS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|