5-bromo-2,6-dimethylpyridine-3-carboxylic acid

C8H8BrNO2 — CID 130636897

IUPAC5-bromo-2,6-dimethylpyridine-3-carboxylic acid
SMILESCc1nc(C)c(C(=O)O)cc1Br
InChIInChI=1S/C8H8BrNO2/c1-4-6(8(11)12)3-7(9)5(2)10-4/h3H,1-2H3,(H,11,12)
InChIKeyHCKJIZJPVNYXEF-UHFFFAOYSA-N
MW230.06 g/mol
LogP2.16
Rot. Bonds1

About 5-bromo-2,6-dimethylpyridine-3-carboxylic acid

5-bromo-2,6-dimethylpyridine-3-carboxylic acid (PubChem CID 130636897) has the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. Its IUPAC name is 5-bromo-2,6-dimethylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-bromo-2,6-dimethylpyridine-3-carboxylic acid
PubChem CID130636897
Molecular FormulaC8H8BrNO2
Molecular Weight230.06 g/mol
Exact Mass228.97
IUPAC Name5-bromo-2,6-dimethylpyridine-3-carboxylic acid
SMILESCc1nc(C)c(C(=O)O)cc1Br
InChIInChI=1S/C8H8BrNO2/c1-4-6(8(11)12)3-7(9)5(2)10-4/h3H,1-2H3,(H,11,12)
InChIKeyHCKJIZJPVNYXEF-UHFFFAOYSA-N
XLogP2.16
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.06
LogP ≤ 52.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-bromo-2,6-dimethylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2,6-dimethylpyridine-3-carboxylic acid?
The IUPAC name of 5-bromo-2,6-dimethylpyridine-3-carboxylic acid (CID 130636897) is 5-bromo-2,6-dimethylpyridine-3-carboxylic acid.
What is the SMILES notation for 5-bromo-2,6-dimethylpyridine-3-carboxylic acid?
The canonical SMILES for 5-bromo-2,6-dimethylpyridine-3-carboxylic acid is Cc1nc(C)c(C(=O)O)cc1Br.
What is the InChIKey of 5-bromo-2,6-dimethylpyridine-3-carboxylic acid?
The InChIKey is HCKJIZJPVNYXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2/c1-4-6(8(11)12)3-7(9)5(2)10-4/h3H,1-2H3,(H,11,12).
What are the key properties of 5-bromo-2,6-dimethylpyridine-3-carboxylic acid?
5-bromo-2,6-dimethylpyridine-3-carboxylic acid has a molecular weight of 230.06 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,6-dimethylpyridine-3-carboxylic acid is sourced from PubChem (CID 130636897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).