C11H20FNO2 — CID 112562754
2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-fluoroethanamine (PubChem CID 112562754) has the molecular formula C11H20FNO2 and a molecular weight of 217.28 g/mol. Its IUPAC name is 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-fluoroethanamine.
| Compound Name | 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 112562754 |
| Molecular Formula | C11H20FNO2 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-fluoroethanamine |
| SMILES | NCC(F)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C11H20FNO2/c12-10(8-13)9-1-4-15-11(7-9)2-5-14-6-3-11/h9-10H,1-8,13H2 |
| InChIKey | BTHXRLMKKMXYDV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |