C12H22FN — CID 112563947
3-(3,4-dimethylcyclohexyl)-3-fluorocyclobutan-1-amine (PubChem CID 112563947) has the molecular formula C12H22FN and a molecular weight of 199.31 g/mol. Its IUPAC name is 3-(3,4-dimethylcyclohexyl)-3-fluorocyclobutan-1-amine.
| Compound Name | 3-(3,4-dimethylcyclohexyl)-3-fluorocyclobutan-1-amine |
|---|---|
| PubChem CID | 112563947 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 3-(3,4-dimethylcyclohexyl)-3-fluorocyclobutan-1-amine |
| SMILES | CC1CCC(C2(F)CC(N)C2)CC1C |
| InChI | InChI=1S/C12H22FN/c1-8-3-4-10(5-9(8)2)12(13)6-11(14)7-12/h8-11H,3-7,14H2,1-2H3 |
| InChIKey | UBVJODJNDLRKSU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |