C11H20OS — CID 131097107
3-(3,4-dimethylcyclohexyl)thietan-3-ol (PubChem CID 131097107) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is 3-(3,4-dimethylcyclohexyl)thietan-3-ol.
| Compound Name | 3-(3,4-dimethylcyclohexyl)thietan-3-ol |
|---|---|
| PubChem CID | 131097107 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-(3,4-dimethylcyclohexyl)thietan-3-ol |
| SMILES | CC1CCC(C2(O)CSC2)CC1C |
| InChI | InChI=1S/C11H20OS/c1-8-3-4-10(5-9(8)2)11(12)6-13-7-11/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | KCLHHALDWDHMAX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |