C11H18FN — CID 112564532
3-fluoro-3-(2-methylprop-1-enyl)-8-azabicyclo[3.2.1]octane (PubChem CID 112564532) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is 3-fluoro-3-(2-methylprop-1-enyl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-fluoro-3-(2-methylprop-1-enyl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 112564532 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 3-fluoro-3-(2-methylprop-1-enyl)-8-azabicyclo[3.2.1]octane |
| SMILES | CC(C)=CC1(F)CC2CCC(C1)N2 |
| InChI | InChI=1S/C11H18FN/c1-8(2)5-11(12)6-9-3-4-10(7-11)13-9/h5,9-10,13H,3-4,6-7H2,1-2H3 |
| InChIKey | ZVZQUDLUNOFIMZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|