2-cyclopentyl-4-hydroxy-3-methylpentanoic acid

C11H20O3 — CID 112569249

IUPAC2-cyclopentyl-4-hydroxy-3-methylpentanoic acid
SMILESCC(O)C(C)C(C(=O)O)C1CCCC1
InChIInChI=1S/C11H20O3/c1-7(8(2)12)10(11(13)14)9-5-3-4-6-9/h7-10,12H,3-6H2,1-2H3,(H,13,14)
InChIKeyQURPHBTWEIATBC-UHFFFAOYSA-N
MW200.28 g/mol
LogP1.89
Rot. Bonds4

About 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid

2-cyclopentyl-4-hydroxy-3-methylpentanoic acid (PubChem CID 112569249) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid.

Molecular Properties

Compound Name2-cyclopentyl-4-hydroxy-3-methylpentanoic acid
PubChem CID112569249
Molecular FormulaC11H20O3
Molecular Weight200.28 g/mol
Exact Mass200.14
IUPAC Name2-cyclopentyl-4-hydroxy-3-methylpentanoic acid
SMILESCC(O)C(C)C(C(=O)O)C1CCCC1
InChIInChI=1S/C11H20O3/c1-7(8(2)12)10(11(13)14)9-5-3-4-6-9/h7-10,12H,3-6H2,1-2H3,(H,13,14)
InChIKeyQURPHBTWEIATBC-UHFFFAOYSA-N
XLogP1.89
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 51.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R,3S)-2-cyclohexyl-3-hydroxybutanoic acid
CID 14660744
2,3-dicyclopentylbutanedioic acid
CID 141323160
(2S)-2-cyclohexyl-3-methylbutanoic acid
CID 69470858
3-amino-2-cyclopentylbutanoic acid
CID 131138399
2-cyclopentyl-3-hydroxypentanoic acid
CID 141134348
4-cyclopentyl-4-hydroxy-2,3-dimethylbutanoic acid
CID 79413893
2-cyclopentyl-3-methylbutanedioic acid;N-ethylethanamine
CID 174671046
2,3-dicyclohexylbutanedioic acid;N-ethylethanamine
CID 174659539
3-cyclohexyl-2-cyclopentyl-4-ethoxy-4-oxobutanoic acid
CID 150375972
(2R)-2-cycloheptyl-2-hydroxyacetic acid
CID 158640375
3-cyclododecylbutan-2-ol
CID 10444334
1-cycloheptylpropane-1,2-diol
CID 103452573

Frequently Asked Questions

What is the IUPAC name of 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid?
The IUPAC name of 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid (CID 112569249) is 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid.
What is the SMILES notation for 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid?
The canonical SMILES for 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid is CC(O)C(C)C(C(=O)O)C1CCCC1.
What is the InChIKey of 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid?
The InChIKey is QURPHBTWEIATBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-7(8(2)12)10(11(13)14)9-5-3-4-6-9/h7-10,12H,3-6H2,1-2H3,(H,13,14).
What are the key properties of 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid?
2-cyclopentyl-4-hydroxy-3-methylpentanoic acid has a molecular weight of 200.28 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-4-hydroxy-3-methylpentanoic acid is sourced from PubChem (CID 112569249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).