C21H18N4O3 — CID 11257328
1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3-methoxyphenyl)urea (PubChem CID 11257328) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 11257328 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(-c3cccc4onc(N)c34)cc2)c1 |
| InChI | InChI=1S/C21H18N4O3/c1-27-16-5-2-4-15(12-16)24-21(26)23-14-10-8-13(9-11-14)17-6-3-7-18-19(17)20(22)25-28-18/h2-12H,1H3,(H2,22,25)(H2,23,24,26) |
| InChIKey | GUKDQMJDSRANAC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |