C20H15FN4O2 — CID 11268446
1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3-fluorophenyl)urea (PubChem CID 11268446) has the molecular formula C20H15FN4O2 and a molecular weight of 362.36 g/mol. Its IUPAC name is 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 11268446 |
| Molecular Formula | C20H15FN4O2 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3-fluorophenyl)urea |
| SMILES | Nc1noc2cccc(-c3ccc(NC(=O)Nc4cccc(F)c4)cc3)c12 |
| InChI | InChI=1S/C20H15FN4O2/c21-13-3-1-4-15(11-13)24-20(26)23-14-9-7-12(8-10-14)16-5-2-6-17-18(16)19(22)25-27-17/h1-11H,(H2,22,25)(H2,23,24,26) |
| InChIKey | UTRWIKREJCMOST-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |