C20H14F2N4O2 — CID 11280431
1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3,5-difluorophenyl)urea (PubChem CID 11280431) has the molecular formula C20H14F2N4O2 and a molecular weight of 380.35 g/mol. Its IUPAC name is 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3,5-difluorophenyl)urea.
| Compound Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 11280431 |
| Molecular Formula | C20H14F2N4O2 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[4-(3-amino-1,2-benzoxazol-4-yl)phenyl]-3-(3,5-difluorophenyl)urea |
| SMILES | Nc1noc2cccc(-c3ccc(NC(=O)Nc4cc(F)cc(F)c4)cc3)c12 |
| InChI | InChI=1S/C20H14F2N4O2/c21-12-8-13(22)10-15(9-12)25-20(27)24-14-6-4-11(5-7-14)16-2-1-3-17-18(16)19(23)26-28-17/h1-10H,(H2,23,26)(H2,24,25,27) |
| InChIKey | ZTLCFWVRTDYRQG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |