C11H14F3N3O2 — CID 112579002
3-amino-2-[2-(2,2,2-trifluoroethoxy)ethylamino]benzamide (PubChem CID 112579002) has the molecular formula C11H14F3N3O2 and a molecular weight of 277.25 g/mol. Its IUPAC name is 3-amino-2-[2-(2,2,2-trifluoroethoxy)ethylamino]benzamide.
| Compound Name | 3-amino-2-[2-(2,2,2-trifluoroethoxy)ethylamino]benzamide |
|---|---|
| PubChem CID | 112579002 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-amino-2-[2-(2,2,2-trifluoroethoxy)ethylamino]benzamide |
| SMILES | NC(=O)c1cccc(N)c1NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O2/c12-11(13,14)6-19-5-4-17-9-7(10(16)18)2-1-3-8(9)15/h1-3,17H,4-6,15H2,(H2,16,18) |
| InChIKey | PTXBAFNHLWQASF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|