C19H29N3O4S — CID 11257957
3-(1,1-dioxothiazinan-2-yl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine (PubChem CID 11257957) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
|---|---|
| PubChem CID | 11257957 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
| SMILES | COc1cc2c(cc1OC)C1CC(N)C(N3CCCCS3(=O)=O)CN1CC2 |
| InChI | InChI=1S/C19H29N3O4S/c1-25-18-9-13-5-7-21-12-17(22-6-3-4-8-27(22,23)24)15(20)11-16(21)14(13)10-19(18)26-2/h9-10,15-17H,3-8,11-12,20H2,1-2H3 |
| InChIKey | ZFIBBFIUTCQDQR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |