C21H32INO3 — CID 70667506
(2R,3R,11bR)-3-(4-iodo-2,2-dimethylbutyl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol (PubChem CID 70667506) has the molecular formula C21H32INO3 and a molecular weight of 473.40 g/mol. Its IUPAC name is (2R,3R,11bR)-3-(4-iodo-2,2-dimethylbutyl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol.
| Compound Name | (2R,3R,11bR)-3-(4-iodo-2,2-dimethylbutyl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 70667506 |
| Molecular Formula | C21H32INO3 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (2R,3R,11bR)-3-(4-iodo-2,2-dimethylbutyl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
| SMILES | COc1cc2c(cc1OC)[C@H]1C[C@@H](O)[C@H](CC(C)(C)CCI)CN1CC2 |
| InChI | InChI=1S/C21H32INO3/c1-21(2,6-7-22)12-15-13-23-8-5-14-9-19(25-3)20(26-4)10-16(14)17(23)11-18(15)24/h9-10,15,17-18,24H,5-8,11-13H2,1-4H3/t15-,17-,18-/m1/s1 |
| InChIKey | NSSIOKISVYEBKH-KBAYOESNSA-N |
| XLogP | 4.23 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|