C22H32ClF2NO3 — CID 168764269
(2R,3R,11bR)-9-(3-chloro-3,3-difluoropropoxy)-3-(2,2-dimethylpropyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol (PubChem CID 168764269) has the molecular formula C22H32ClF2NO3 and a molecular weight of 431.95 g/mol. Its IUPAC name is (2R,3R,11bR)-9-(3-chloro-3,3-difluoropropoxy)-3-(2,2-dimethylpropyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol.
| Compound Name | (2R,3R,11bR)-9-(3-chloro-3,3-difluoropropoxy)-3-(2,2-dimethylpropyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 168764269 |
| Molecular Formula | C22H32ClF2NO3 |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (2R,3R,11bR)-9-(3-chloro-3,3-difluoropropoxy)-3-(2,2-dimethylpropyl)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
| SMILES | COc1cc2c(cc1OCCC(F)(F)Cl)CCN1C[C@@H](CC(C)(C)C)[C@H](O)C[C@H]21 |
| InChI | InChI=1S/C22H32ClF2NO3/c1-21(2,3)12-15-13-26-7-5-14-9-20(29-8-6-22(23,24)25)19(28-4)10-16(14)17(26)11-18(15)27/h9-10,15,17-18,27H,5-8,11-13H2,1-4H3/t15-,17-,18-/m1/s1 |
| InChIKey | COPUTSZYYODZSE-KBAYOESNSA-N |
| XLogP | 5.01 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|