C24H36FNO3 — CID 170648666
3-(2,2-dimethylpropyl)-9-(2-fluorocyclopentyl)oxy-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol (PubChem CID 170648666) has the molecular formula C24H36FNO3 and a molecular weight of 405.55 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-9-(2-fluorocyclopentyl)oxy-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol.
| Compound Name | 3-(2,2-dimethylpropyl)-9-(2-fluorocyclopentyl)oxy-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 170648666 |
| Molecular Formula | C24H36FNO3 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-9-(2-fluorocyclopentyl)oxy-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
| SMILES | COc1cc2c(cc1OC1CCCC1F)CCN1CC(CC(C)(C)C)C(O)CC21 |
| InChI | InChI=1S/C24H36FNO3/c1-24(2,3)13-16-14-26-9-8-15-10-23(29-21-7-5-6-18(21)25)22(28-4)11-17(15)19(26)12-20(16)27/h10-11,16,18-21,27H,5-9,12-14H2,1-4H3 |
| InChIKey | KXNMCUDNKTVTBU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |