C22H34FNO3 — CID 170648714
3-(2,2-dimethylpropyl)-9-(3-fluoropropoxy)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol (PubChem CID 170648714) has the molecular formula C22H34FNO3 and a molecular weight of 379.52 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-9-(3-fluoropropoxy)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol.
| Compound Name | 3-(2,2-dimethylpropyl)-9-(3-fluoropropoxy)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 170648714 |
| Molecular Formula | C22H34FNO3 |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-9-(3-fluoropropoxy)-10-methoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
| SMILES | COc1cc2c(cc1OCCCF)CCN1CC(CC(C)(C)C)C(O)CC21 |
| InChI | InChI=1S/C22H34FNO3/c1-22(2,3)13-16-14-24-8-6-15-10-21(27-9-5-7-23)20(26-4)11-17(15)18(24)12-19(16)25/h10-11,16,18-19,25H,5-9,12-14H2,1-4H3 |
| InChIKey | SFVMBONSIQMSKX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|