C13H22N2O3 — CID 112581577
methyl 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)azetidine-2-carboxylate (PubChem CID 112581577) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)azetidine-2-carboxylate.
| Compound Name | methyl 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 112581577 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | methyl 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)azetidine-2-carboxylate |
| SMILES | COC(=O)C1CCN1CC1CN2CCCC2CO1 |
| InChI | InChI=1S/C13H22N2O3/c1-17-13(16)12-4-6-15(12)8-11-7-14-5-2-3-10(14)9-18-11/h10-12H,2-9H2,1H3 |
| InChIKey | VYQQADJLLUNYIQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |